About CID 167558814
CID 167558814 (PubChem CID 167558814) has the molecular formula C11H7BF6O4
and a molecular weight of 327.97 g/mol.
Molecular Properties
| Compound Name | CID 167558814 |
| PubChem CID | 167558814 |
| Molecular Formula | C11H7BF6O4 |
| Molecular Weight | 327.97 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | — |
| SMILES | [B]Cc1ccccc1OC(C(=O)OO)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H7BF6O4/c12-5-6-3-1-2-4-7(6)21-9(8(19)22-20,10(13,14)15)11(16,17)18/h1-4,20H,5H2 |
| InChIKey | APBMAQLJKUSZGK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.97 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 167558814 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167558814?
The IUPAC name of CID 167558814 (CID 167558814) is not available.
What is the SMILES notation for CID 167558814?
The canonical SMILES for CID 167558814 is [B]Cc1ccccc1OC(C(=O)OO)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of CID 167558814?
The InChIKey is APBMAQLJKUSZGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BF6O4/c12-5-6-3-1-2-4-7(6)21-9(8(19)22-20,10(13,14)15)11(16,17)18/h1-4,20H,5H2.
What are the key properties of CID 167558814?
CID 167558814 has a molecular weight of 327.97 g/mol, XLogP of 2.61, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167558814 is sourced from PubChem (CID 167558814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).