C35H56O9 — CID 167567933
(4-hydroxyphenyl) 2,2-dimethylbutanoate;methyl 3,4-diethyloxolane-3-carboxylate;7-oxabicyclo[4.1.0]heptan-3-ylmethyl 2,2-dimethylbutanoate (PubChem CID 167567933) has the molecular formula C35H56O9 and a molecular weight of 620.82 g/mol. Its IUPAC name is (4-hydroxyphenyl) 2,2-dimethylbutanoate;methyl 3,4-diethyloxolane-3-carboxylate;7-oxabicyclo[4.1.0]heptan-3-ylmethyl 2,2-dimethylbutanoate.
| Compound Name | (4-hydroxyphenyl) 2,2-dimethylbutanoate;methyl 3,4-diethyloxolane-3-carboxylate;7-oxabicyclo[4.1.0]heptan-3-ylmethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 167567933 |
| Molecular Formula | C35H56O9 |
| Molecular Weight | 620.82 g/mol |
| Exact Mass | 620.39 |
| IUPAC Name | (4-hydroxyphenyl) 2,2-dimethylbutanoate;methyl 3,4-diethyloxolane-3-carboxylate;7-oxabicyclo[4.1.0]heptan-3-ylmethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC1CCC2OC2C1.CCC(C)(C)C(=O)Oc1ccc(O)cc1.CCC1COCC1(CC)C(=O)OC |
| InChI | InChI=1S/C13H22O3.C12H16O3.C10H18O3/c1-4-13(2,3)12(14)15-8-9-5-6-10-11(7-9)16-10;1-4-12(2,3)11(14)15-10-7-5-9(13)6-8-10;1-4-8-6-13-7-10(8,5-2)9(11)12-3/h9-11H,4-8H2,1-3H3;5-8,13H,4H2,1-3H3;8H,4-7H2,1-3H3 |
| InChIKey | FNHSNPZXWTXTPD-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.82 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|