C20H29N5O2S — CID 167572656
(2S)-6-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxy-2-(methylamino)hexan-3-one (PubChem CID 167572656) has the molecular formula C20H29N5O2S and a molecular weight of 403.55 g/mol. Its IUPAC name is (2S)-6-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxy-2-(methylamino)hexan-3-one.
| Compound Name | (2S)-6-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxy-2-(methylamino)hexan-3-one |
|---|---|
| PubChem CID | 167572656 |
| Molecular Formula | C20H29N5O2S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (2S)-6-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxy-2-(methylamino)hexan-3-one |
| SMILES | CCc1nc(Nc2ncc(C3CCC3)s2)cc(OCCCC(=O)[C@H](C)NC)n1 |
| InChI | InChI=1S/C20H29N5O2S/c1-4-17-23-18(25-20-22-12-16(28-20)14-7-5-8-14)11-19(24-17)27-10-6-9-15(26)13(2)21-3/h11-14,21H,4-10H2,1-3H3,(H,22,23,24,25)/t13-/m0/s1 |
| InChIKey | KOUVXSMGRNCCGQ-ZDUSSCGKSA-N |
| XLogP | 3.84 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|