C19H29NO6 — CID 16758320
(3R,7Z,9S,10R,15Z,17R)-10-methoxy-3,9,17-trimethyl-1,12-dioxa-4-azacyclooctadeca-7,15-diene-2,5,13-trione (PubChem CID 16758320) has the molecular formula C19H29NO6 and a molecular weight of 367.44 g/mol. Its IUPAC name is (3R,7Z,9S,10R,15Z,17R)-10-methoxy-3,9,17-trimethyl-1,12-dioxa-4-azacyclooctadeca-7,15-diene-2,5,13-trione.
| Compound Name | (3R,7Z,9S,10R,15Z,17R)-10-methoxy-3,9,17-trimethyl-1,12-dioxa-4-azacyclooctadeca-7,15-diene-2,5,13-trione |
|---|---|
| PubChem CID | 16758320 |
| Molecular Formula | C19H29NO6 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (3R,7Z,9S,10R,15Z,17R)-10-methoxy-3,9,17-trimethyl-1,12-dioxa-4-azacyclooctadeca-7,15-diene-2,5,13-trione |
| SMILES | CO[C@H]1COC(=O)C/C=C\[C@@H](C)COC(=O)[C@@H](C)NC(=O)C/C=C\[C@@H]1C |
| InChI | InChI=1S/C19H29NO6/c1-13-7-5-10-18(22)25-12-16(24-4)14(2)8-6-9-17(21)20-15(3)19(23)26-11-13/h5-8,13-16H,9-12H2,1-4H3,(H,20,21)/b7-5-,8-6-/t13-,14+,15-,16+/m1/s1 |
| InChIKey | LWDPMOSNANKXAG-VREFTYSFSA-N |
| XLogP | 1.77 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|