C19H18N4O6S — CID 167590231
3,5-dimethyl-N-[2-(6-methylidene-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-1,2-oxazole-4-sulfonamide (PubChem CID 167590231) has the molecular formula C19H18N4O6S and a molecular weight of 430.44 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-(6-methylidene-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-1,2-oxazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-[2-(6-methylidene-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 167590231 |
| Molecular Formula | C19H18N4O6S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 3,5-dimethyl-N-[2-(6-methylidene-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-1,2-oxazole-4-sulfonamide |
| SMILES | C=C1CCC(N2C(=O)c3ccc(NS(=O)(=O)c4c(C)noc4C)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H18N4O6S/c1-9-4-7-15(17(24)20-9)23-18(25)13-6-5-12(8-14(13)19(23)26)22-30(27,28)16-10(2)21-29-11(16)3/h5-6,8,15,22H,1,4,7H2,2-3H3,(H,20,24) |
| InChIKey | NOJCOHUIBDBEEU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|