C48H55N2O3+ — CID 167592565
1-[3-[bis(4-methoxyphenyl)-phenylmethoxy]propyl]-N,N-diethyl-3,3-dimethyl-2-[(E)-4-phenylbut-1-enyl]indol-1-ium-5-amine (PubChem CID 167592565) has the molecular formula C48H55N2O3+ and a molecular weight of 707.98 g/mol. Its IUPAC name is 1-[3-[bis(4-methoxyphenyl)-phenylmethoxy]propyl]-N,N-diethyl-3,3-dimethyl-2-[(E)-4-phenylbut-1-enyl]indol-1-ium-5-amine.
| Compound Name | 1-[3-[bis(4-methoxyphenyl)-phenylmethoxy]propyl]-N,N-diethyl-3,3-dimethyl-2-[(E)-4-phenylbut-1-enyl]indol-1-ium-5-amine |
|---|---|
| PubChem CID | 167592565 |
| Molecular Formula | C48H55N2O3+ |
| Molecular Weight | 707.98 g/mol |
| Exact Mass | 707.42 |
| IUPAC Name | 1-[3-[bis(4-methoxyphenyl)-phenylmethoxy]propyl]-N,N-diethyl-3,3-dimethyl-2-[(E)-4-phenylbut-1-enyl]indol-1-ium-5-amine |
| SMILES | CCN(CC)c1ccc2c(c1)C(C)(C)C(/C=C/CCc1ccccc1)=[N+]2CCCOC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C48H55N2O3/c1-7-49(8-2)41-28-33-45-44(36-41)47(3,4)46(23-16-15-20-37-18-11-9-12-19-37)50(45)34-17-35-53-48(38-21-13-10-14-22-38,39-24-29-42(51-5)30-25-39)40-26-31-43(52-6)32-27-40/h9-14,16,18-19,21-33,36H,7-8,15,17,20,34-35H2,1-6H3/q+1/b23-16+ |
| InChIKey | RYRJDXMJGAJMMX-XQNSMLJCSA-N |
| XLogP | 10.51 |
| TPSA | 33.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.98 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|