C18H24N2O6 — CID 167596236
1-[(2R,3R,4R)-4-(7-hydroxy-6-methoxyindazol-2-yl)-3,6-dimethyl-3,4-dihydro-2H-pyran-2-yl]propane-1,2,3-triol (PubChem CID 167596236) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is 1-[(2R,3R,4R)-4-(7-hydroxy-6-methoxyindazol-2-yl)-3,6-dimethyl-3,4-dihydro-2H-pyran-2-yl]propane-1,2,3-triol.
| Compound Name | 1-[(2R,3R,4R)-4-(7-hydroxy-6-methoxyindazol-2-yl)-3,6-dimethyl-3,4-dihydro-2H-pyran-2-yl]propane-1,2,3-triol |
|---|---|
| PubChem CID | 167596236 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1-[(2R,3R,4R)-4-(7-hydroxy-6-methoxyindazol-2-yl)-3,6-dimethyl-3,4-dihydro-2H-pyran-2-yl]propane-1,2,3-triol |
| SMILES | COc1ccc2cn([C@H]3C=C(C)O[C@@H](C(O)C(O)CO)[C@@H]3C)nc2c1O |
| InChI | InChI=1S/C18H24N2O6/c1-9-6-12(10(2)18(26-9)16(23)13(22)8-21)20-7-11-4-5-14(25-3)17(24)15(11)19-20/h4-7,10,12-13,16,18,21-24H,8H2,1-3H3/t10-,12+,13?,16?,18-/m1/s1 |
| InChIKey | KIMSELPKNVACKC-BOUOWSORSA-N |
| XLogP | 0.94 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |