C22H35O7P — CID 167606766
(2S,3R,4R,5S)-2-[(E)-2-[bis(2-methoxypropan-2-yloxy)phosphoryl]ethenyl]-4-methoxy-3-methyl-5-phenyloxolane (PubChem CID 167606766) has the molecular formula C22H35O7P and a molecular weight of 442.49 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2-[(E)-2-[bis(2-methoxypropan-2-yloxy)phosphoryl]ethenyl]-4-methoxy-3-methyl-5-phenyloxolane.
| Compound Name | (2S,3R,4R,5S)-2-[(E)-2-[bis(2-methoxypropan-2-yloxy)phosphoryl]ethenyl]-4-methoxy-3-methyl-5-phenyloxolane |
|---|---|
| PubChem CID | 167606766 |
| Molecular Formula | C22H35O7P |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | (2S,3R,4R,5S)-2-[(E)-2-[bis(2-methoxypropan-2-yloxy)phosphoryl]ethenyl]-4-methoxy-3-methyl-5-phenyloxolane |
| SMILES | CO[C@@H]1[C@H](C)[C@@H](/C=C/P(=O)(OC(C)(C)OC)OC(C)(C)OC)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H35O7P/c1-16-18(27-20(19(16)24-6)17-12-10-9-11-13-17)14-15-30(23,28-21(2,3)25-7)29-22(4,5)26-8/h9-16,18-20H,1-8H3/b15-14+/t16-,18-,19-,20+/m1/s1 |
| InChIKey | QGTLIRRVAVQJBS-SPJAQLDOSA-N |
| XLogP | 5.28 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|