C16H22FO4P — CID 164947524
[(E)-2-[(2R,3R,4S,5S)-4-fluoro-5-phenyl-3-propan-2-yloxyoxolan-2-yl]ethenyl]-methylphosphinic acid (PubChem CID 164947524) has the molecular formula C16H22FO4P and a molecular weight of 328.32 g/mol. Its IUPAC name is [(E)-2-[(2R,3R,4S,5S)-4-fluoro-5-phenyl-3-propan-2-yloxyoxolan-2-yl]ethenyl]-methylphosphinic acid.
| Compound Name | [(E)-2-[(2R,3R,4S,5S)-4-fluoro-5-phenyl-3-propan-2-yloxyoxolan-2-yl]ethenyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 164947524 |
| Molecular Formula | C16H22FO4P |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | [(E)-2-[(2R,3R,4S,5S)-4-fluoro-5-phenyl-3-propan-2-yloxyoxolan-2-yl]ethenyl]-methylphosphinic acid |
| SMILES | CC(C)O[C@H]1[C@@H](F)[C@H](c2ccccc2)O[C@@H]1/C=C/P(C)(=O)O |
| InChI | InChI=1S/C16H22FO4P/c1-11(2)20-16-13(9-10-22(3,18)19)21-15(14(16)17)12-7-5-4-6-8-12/h4-11,13-16H,1-3H3,(H,18,19)/b10-9+/t13-,14+,15+,16-/m1/s1 |
| InChIKey | QIYROTJLIZHUGV-QXVXDDNNSA-N |
| XLogP | 3.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|