C23H27N5O2S — CID 167606831
1-(4-morpholin-4-ylphenyl)-3-(1-thieno[3,2-b]pyridin-7-ylpiperidin-4-yl)urea (PubChem CID 167606831) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is 1-(4-morpholin-4-ylphenyl)-3-(1-thieno[3,2-b]pyridin-7-ylpiperidin-4-yl)urea.
| Compound Name | 1-(4-morpholin-4-ylphenyl)-3-(1-thieno[3,2-b]pyridin-7-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 167606831 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 1-(4-morpholin-4-ylphenyl)-3-(1-thieno[3,2-b]pyridin-7-ylpiperidin-4-yl)urea |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)NC1CCN(c2ccnc3ccsc23)CC1 |
| InChI | InChI=1S/C23H27N5O2S/c29-23(25-17-1-3-19(4-2-17)27-12-14-30-15-13-27)26-18-6-10-28(11-7-18)21-5-9-24-20-8-16-31-22(20)21/h1-5,8-9,16,18H,6-7,10-15H2,(H2,25,26,29) |
| InChIKey | OGIMNFZCOIIGCF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|