C18H26BBrN4O2 — CID 167607695
5-bromo-6-methylpyridin-2-amine;cyclopropylboronic acid;5-cyclopropyl-6-methylpyridin-2-amine (PubChem CID 167607695) has the molecular formula C18H26BBrN4O2 and a molecular weight of 421.15 g/mol. Its IUPAC name is 5-bromo-6-methylpyridin-2-amine;cyclopropylboronic acid;5-cyclopropyl-6-methylpyridin-2-amine.
| Compound Name | 5-bromo-6-methylpyridin-2-amine;cyclopropylboronic acid;5-cyclopropyl-6-methylpyridin-2-amine |
|---|---|
| PubChem CID | 167607695 |
| Molecular Formula | C18H26BBrN4O2 |
| Molecular Weight | 421.15 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 5-bromo-6-methylpyridin-2-amine;cyclopropylboronic acid;5-cyclopropyl-6-methylpyridin-2-amine |
| SMILES | Cc1nc(N)ccc1Br.Cc1nc(N)ccc1C1CC1.OB(O)C1CC1 |
| InChI | InChI=1S/C9H12N2.C6H7BrN2.C3H7BO2/c1-6-8(7-2-3-7)4-5-9(10)11-6;1-4-5(7)2-3-6(8)9-4;5-4(6)3-1-2-3/h4-5,7H,2-3H2,1H3,(H2,10,11);2-3H,1H3,(H2,8,9);3,5-6H,1-2H2 |
| InChIKey | KPNCNSLNSDXJEA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.15 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|