C23H31N5O3S — CID 167651343
N-[(2S)-6-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxy-3-oxohexan-2-yl]-N-methylprop-2-enamide (PubChem CID 167651343) has the molecular formula C23H31N5O3S and a molecular weight of 457.60 g/mol. Its IUPAC name is N-[(2S)-6-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxy-3-oxohexan-2-yl]-N-methylprop-2-enamide.
| Compound Name | N-[(2S)-6-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxy-3-oxohexan-2-yl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 167651343 |
| Molecular Formula | C23H31N5O3S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | N-[(2S)-6-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxy-3-oxohexan-2-yl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)[C@@H](C)C(=O)CCCOc1cc(Nc2ncc(C3CCC3)s2)nc(CC)n1 |
| InChI | InChI=1S/C23H31N5O3S/c1-5-19-25-20(27-23-24-14-18(32-23)16-9-7-10-16)13-21(26-19)31-12-8-11-17(29)15(3)28(4)22(30)6-2/h6,13-16H,2,5,7-12H2,1,3-4H3,(H,24,25,26,27)/t15-/m0/s1 |
| InChIKey | JQFBVJXIJSZSAT-HNNXBMFYSA-N |
| XLogP | 4.27 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|