C8H15O2Y- — CID 167654014
(2R,3R,5S)-3-ethoxy-2-methanidyl-5-methyloxolane;yttrium (PubChem CID 167654014) has the molecular formula C8H15O2Y- and a molecular weight of 232.11 g/mol. Its IUPAC name is (2R,3R,5S)-3-ethoxy-2-methanidyl-5-methyloxolane;yttrium.
| Compound Name | (2R,3R,5S)-3-ethoxy-2-methanidyl-5-methyloxolane;yttrium |
|---|---|
| PubChem CID | 167654014 |
| Molecular Formula | C8H15O2Y- |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | (2R,3R,5S)-3-ethoxy-2-methanidyl-5-methyloxolane;yttrium |
| SMILES | [CH2-][C@H]1O[C@@H](C)C[C@H]1OCC.[Y] |
| InChI | InChI=1S/C8H15O2.Y/c1-4-9-8-5-6(2)10-7(8)3;/h6-8H,3-5H2,1-2H3;/q-1;/t6-,7+,8+;/m0./s1 |
| InChIKey | VKFXHZGCYMLJIX-HNPMAXIBSA-N |
| XLogP | 1.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|