C8H16O3 — CID 59893392
(2R)-3,4-dimethoxy-2,5-dimethyloxolane (PubChem CID 59893392) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (2R)-3,4-dimethoxy-2,5-dimethyloxolane.
| Compound Name | (2R)-3,4-dimethoxy-2,5-dimethyloxolane |
|---|---|
| PubChem CID | 59893392 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (2R)-3,4-dimethoxy-2,5-dimethyloxolane |
| SMILES | COC1C(C)O[C@H](C)C1OC |
| InChI | InChI=1S/C8H16O3/c1-5-7(9-3)8(10-4)6(2)11-5/h5-8H,1-4H3/t5-,6?,7?,8?/m1/s1 |
| InChIKey | RITAQNSNFKWWSM-NIYQRSRNSA-N |
| XLogP | 0.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |