C10H22F2N2O2 — CID 167667741
(2S,3S)-6-(1-aminoethyl)-4,5-difluoro-2-methoxyoxan-3-amine;ethane (PubChem CID 167667741) has the molecular formula C10H22F2N2O2 and a molecular weight of 240.29 g/mol. Its IUPAC name is (2S,3S)-6-(1-aminoethyl)-4,5-difluoro-2-methoxyoxan-3-amine;ethane.
| Compound Name | (2S,3S)-6-(1-aminoethyl)-4,5-difluoro-2-methoxyoxan-3-amine;ethane |
|---|---|
| PubChem CID | 167667741 |
| Molecular Formula | C10H22F2N2O2 |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | (2S,3S)-6-(1-aminoethyl)-4,5-difluoro-2-methoxyoxan-3-amine;ethane |
| SMILES | CC.CO[C@H]1OC(C(C)N)C(F)C(F)[C@H]1N |
| InChI | InChI=1S/C8H16F2N2O2.C2H6/c1-3(11)7-5(10)4(9)6(12)8(13-2)14-7;1-2/h3-8H,11-12H2,1-2H3;1-2H3/t3?,4?,5?,6-,7?,8+;/m1./s1 |
| InChIKey | SWPUSWRREACALP-FLYMKTNDSA-N |
| XLogP | 0.73 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |