C8H17NO2 — CID 91055081
1-(3-methoxyoxiran-2-yl)-N,2-dimethylpropan-1-amine (PubChem CID 91055081) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is 1-(3-methoxyoxiran-2-yl)-N,2-dimethylpropan-1-amine.
| Compound Name | 1-(3-methoxyoxiran-2-yl)-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 91055081 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 1-(3-methoxyoxiran-2-yl)-N,2-dimethylpropan-1-amine |
| SMILES | CNC(C(C)C)C1OC1OC |
| InChI | InChI=1S/C8H17NO2/c1-5(2)6(9-3)7-8(10-4)11-7/h5-9H,1-4H3 |
| InChIKey | SAYOYVNXYZOMDA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 33.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|