C30H46N4O3 — CID 167671409
(14S)-20-acetyl-14,15-dimethyl-23-(3-methylbutyl)-12,15,18,19-tetrazatricyclo[16.6.1.021,25]pentacosa-1(25),19,21,23-tetraene-13,16-dione (PubChem CID 167671409) has the molecular formula C30H46N4O3 and a molecular weight of 510.72 g/mol. Its IUPAC name is (14S)-20-acetyl-14,15-dimethyl-23-(3-methylbutyl)-12,15,18,19-tetrazatricyclo[16.6.1.021,25]pentacosa-1(25),19,21,23-tetraene-13,16-dione.
| Compound Name | (14S)-20-acetyl-14,15-dimethyl-23-(3-methylbutyl)-12,15,18,19-tetrazatricyclo[16.6.1.021,25]pentacosa-1(25),19,21,23-tetraene-13,16-dione |
|---|---|
| PubChem CID | 167671409 |
| Molecular Formula | C30H46N4O3 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.36 |
| IUPAC Name | (14S)-20-acetyl-14,15-dimethyl-23-(3-methylbutyl)-12,15,18,19-tetrazatricyclo[16.6.1.021,25]pentacosa-1(25),19,21,23-tetraene-13,16-dione |
| SMILES | CC(=O)c1nn2c3c(cc(CCC(C)C)cc13)CCCCCCCCCCNC(=O)[C@H](C)N(C)C(=O)C2 |
| InChI | InChI=1S/C30H46N4O3/c1-21(2)15-16-24-18-25-14-12-10-8-6-7-9-11-13-17-31-30(37)22(3)33(5)27(36)20-34-29(25)26(19-24)28(32-34)23(4)35/h18-19,21-22H,6-17,20H2,1-5H3,(H,31,37)/t22-/m0/s1 |
| InChIKey | MRMLJXMBFWFANZ-QFIPXVFZSA-N |
| XLogP | 5.47 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |