C28H43N5O3 — CID 167672855
(14S)-20-acetyl-14,15-dimethyl-23-(propan-2-ylamino)-12,15,18,19-tetrazatricyclo[16.6.1.021,25]pentacosa-1(25),19,21,23-tetraene-13,16-dione (PubChem CID 167672855) has the molecular formula C28H43N5O3 and a molecular weight of 497.68 g/mol. Its IUPAC name is (14S)-20-acetyl-14,15-dimethyl-23-(propan-2-ylamino)-12,15,18,19-tetrazatricyclo[16.6.1.021,25]pentacosa-1(25),19,21,23-tetraene-13,16-dione.
| Compound Name | (14S)-20-acetyl-14,15-dimethyl-23-(propan-2-ylamino)-12,15,18,19-tetrazatricyclo[16.6.1.021,25]pentacosa-1(25),19,21,23-tetraene-13,16-dione |
|---|---|
| PubChem CID | 167672855 |
| Molecular Formula | C28H43N5O3 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.34 |
| IUPAC Name | (14S)-20-acetyl-14,15-dimethyl-23-(propan-2-ylamino)-12,15,18,19-tetrazatricyclo[16.6.1.021,25]pentacosa-1(25),19,21,23-tetraene-13,16-dione |
| SMILES | CC(=O)c1nn2c3c(cc(NC(C)C)cc13)CCCCCCCCCCNC(=O)[C@H](C)N(C)C(=O)C2 |
| InChI | InChI=1S/C28H43N5O3/c1-19(2)30-23-16-22-14-12-10-8-6-7-9-11-13-15-29-28(36)20(3)32(5)25(35)18-33-27(22)24(17-23)26(31-33)21(4)34/h16-17,19-20,30H,6-15,18H2,1-5H3,(H,29,36)/t20-/m0/s1 |
| InChIKey | GLQFPJKAYLHNCM-FQEVSTJZSA-N |
| XLogP | 4.70 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |