C47H70O2 — CID 167674436
2-[(2E,6E,10E,14E,18E,22E,26E)-3,7,11,15,19,23,27-heptamethylnonacosa-2,6,10,14,18,22,26-heptaenyl]-3-methyl-1,4-dihydronaphthalene-1,4-diol (PubChem CID 167674436) has the molecular formula C47H70O2 and a molecular weight of 667.08 g/mol. Its IUPAC name is 2-[(2E,6E,10E,14E,18E,22E,26E)-3,7,11,15,19,23,27-heptamethylnonacosa-2,6,10,14,18,22,26-heptaenyl]-3-methyl-1,4-dihydronaphthalene-1,4-diol.
| Compound Name | 2-[(2E,6E,10E,14E,18E,22E,26E)-3,7,11,15,19,23,27-heptamethylnonacosa-2,6,10,14,18,22,26-heptaenyl]-3-methyl-1,4-dihydronaphthalene-1,4-diol |
|---|---|
| PubChem CID | 167674436 |
| Molecular Formula | C47H70O2 |
| Molecular Weight | 667.08 g/mol |
| Exact Mass | 666.54 |
| IUPAC Name | 2-[(2E,6E,10E,14E,18E,22E,26E)-3,7,11,15,19,23,27-heptamethylnonacosa-2,6,10,14,18,22,26-heptaenyl]-3-methyl-1,4-dihydronaphthalene-1,4-diol |
| SMILES | CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC1=C(C)C(O)c2ccccc2C1O |
| InChI | InChI=1S/C47H70O2/c1-10-35(2)19-13-20-36(3)21-14-22-37(4)23-15-24-38(5)25-16-26-39(6)27-17-28-40(7)29-18-30-41(8)33-34-43-42(9)46(48)44-31-11-12-32-45(44)47(43)49/h11-12,19,21,23,25,27,29,31-33,46-49H,10,13-18,20,22,24,26,28,30,34H2,1-9H3/b35-19+,36-21+,37-23+,38-25+,39-27+,40-29+,41-33+ |
| InChIKey | CRMIUCMDZKMLEO-DQAUYYDSSA-N |
| XLogP | 14.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.08 |
| LogP ≤ 5 | 14.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|