C19H28O4 — CID 167677214
[2-(4-butan-2-ylphenoxy)-4,5-dimethyloxan-3-yl] acetate (PubChem CID 167677214) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is [2-(4-butan-2-ylphenoxy)-4,5-dimethyloxan-3-yl] acetate.
| Compound Name | [2-(4-butan-2-ylphenoxy)-4,5-dimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 167677214 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | [2-(4-butan-2-ylphenoxy)-4,5-dimethyloxan-3-yl] acetate |
| SMILES | CCC(C)c1ccc(OC2OCC(C)C(C)C2OC(C)=O)cc1 |
| InChI | InChI=1S/C19H28O4/c1-6-12(2)16-7-9-17(10-8-16)23-19-18(22-15(5)20)14(4)13(3)11-21-19/h7-10,12-14,18-19H,6,11H2,1-5H3 |
| InChIKey | HMWYMKSRUIQSTH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |