C12H10Cl2N2O2 — CID 167678767
3-(2,4-dichloro-5-hydroxyphenyl)-1,6-dimethylpyridazin-4-one (PubChem CID 167678767) has the molecular formula C12H10Cl2N2O2 and a molecular weight of 285.13 g/mol. Its IUPAC name is 3-(2,4-dichloro-5-hydroxyphenyl)-1,6-dimethylpyridazin-4-one.
| Compound Name | 3-(2,4-dichloro-5-hydroxyphenyl)-1,6-dimethylpyridazin-4-one |
|---|---|
| PubChem CID | 167678767 |
| Molecular Formula | C12H10Cl2N2O2 |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 3-(2,4-dichloro-5-hydroxyphenyl)-1,6-dimethylpyridazin-4-one |
| SMILES | Cc1cc(=O)c(-c2cc(O)c(Cl)cc2Cl)nn1C |
| InChI | InChI=1S/C12H10Cl2N2O2/c1-6-3-11(18)12(15-16(6)2)7-4-10(17)9(14)5-8(7)13/h3-5,17H,1-2H3 |
| InChIKey | VFEKWILDHRSSPN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |