C32H29NO2 — CID 167713831
2,2-dimethyl-4,6,8-tris(2-methylphenyl)-5H-[1,3]dioxolo[4,5-f]indole (PubChem CID 167713831) has the molecular formula C32H29NO2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 2,2-dimethyl-4,6,8-tris(2-methylphenyl)-5H-[1,3]dioxolo[4,5-f]indole.
| Compound Name | 2,2-dimethyl-4,6,8-tris(2-methylphenyl)-5H-[1,3]dioxolo[4,5-f]indole |
|---|---|
| PubChem CID | 167713831 |
| Molecular Formula | C32H29NO2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 2,2-dimethyl-4,6,8-tris(2-methylphenyl)-5H-[1,3]dioxolo[4,5-f]indole |
| SMILES | Cc1ccccc1-c1cc2c(-c3ccccc3C)c3c(c(-c4ccccc4C)c2[nH]1)OC(C)(C)O3 |
| InChI | InChI=1S/C32H29NO2/c1-19-12-6-9-15-22(19)26-18-25-27(23-16-10-7-13-20(23)2)30-31(35-32(4,5)34-30)28(29(25)33-26)24-17-11-8-14-21(24)3/h6-18,33H,1-5H3 |
| InChIKey | PTSCPRNJLGGYAP-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |