C12H15F2NO4 — CID 167720188
2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)-2-(prop-2-enoxycarbonylamino)acetic acid (PubChem CID 167720188) has the molecular formula C12H15F2NO4 and a molecular weight of 275.25 g/mol. Its IUPAC name is 2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)-2-(prop-2-enoxycarbonylamino)acetic acid.
| Compound Name | 2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)-2-(prop-2-enoxycarbonylamino)acetic acid |
|---|---|
| PubChem CID | 167720188 |
| Molecular Formula | C12H15F2NO4 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)-2-(prop-2-enoxycarbonylamino)acetic acid |
| SMILES | C=CCOC(=O)NC(C(=O)O)C1CC2C(C1)C2(F)F |
| InChI | InChI=1S/C12H15F2NO4/c1-2-3-19-11(18)15-9(10(16)17)6-4-7-8(5-6)12(7,13)14/h2,6-9H,1,3-5H2,(H,15,18)(H,16,17) |
| InChIKey | ZMTQQHWSIKWZTE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|