C18H15N5O3 — CID 167753168
4-[(5-acetyl-2-methoxyphenyl)methyl]-3,5,8,10,13-pentazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 167753168) has the molecular formula C18H15N5O3 and a molecular weight of 349.35 g/mol. Its IUPAC name is 4-[(5-acetyl-2-methoxyphenyl)methyl]-3,5,8,10,13-pentazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 4-[(5-acetyl-2-methoxyphenyl)methyl]-3,5,8,10,13-pentazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 167753168 |
| Molecular Formula | C18H15N5O3 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 4-[(5-acetyl-2-methoxyphenyl)methyl]-3,5,8,10,13-pentazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | COc1ccc(C(C)=O)cc1Cc1nc2c([nH]c3nccnc32)c(=O)[nH]1 |
| InChI | InChI=1S/C18H15N5O3/c1-9(24)10-3-4-12(26-2)11(7-10)8-13-21-14-15-17(20-6-5-19-15)23-16(14)18(25)22-13/h3-7H,8H2,1-2H3,(H,20,23)(H,21,22,25) |
| InChIKey | NGVUCCUJZFRMIR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |