C14H15N3O4 — CID 869185
5-[(5-acetyl-2-methoxyphenyl)methyl]-2-amino-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 869185) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is 5-[(5-acetyl-2-methoxyphenyl)methyl]-2-amino-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 5-[(5-acetyl-2-methoxyphenyl)methyl]-2-amino-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 869185 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 5-[(5-acetyl-2-methoxyphenyl)methyl]-2-amino-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | COc1ccc(C(C)=O)cc1Cc1c(O)nc(N)[nH]c1=O |
| InChI | InChI=1S/C14H15N3O4/c1-7(18)8-3-4-11(21-2)9(5-8)6-10-12(19)16-14(15)17-13(10)20/h3-5H,6H2,1-2H3,(H4,15,16,17,19,20) |
| InChIKey | LGENMLRLGNUBLB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |