C14H17N5O3 — CID 5413798
2-amino-5-[(5-ethanehydrazonoyl-2-methoxyphenyl)methyl]-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 5413798) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-amino-5-[(5-ethanehydrazonoyl-2-methoxyphenyl)methyl]-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 2-amino-5-[(5-ethanehydrazonoyl-2-methoxyphenyl)methyl]-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 5413798 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-amino-5-[(5-ethanehydrazonoyl-2-methoxyphenyl)methyl]-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | COc1ccc(/C(C)=N\N)cc1Cc1c(O)nc(N)[nH]c1=O |
| InChI | InChI=1S/C14H17N5O3/c1-7(19-16)8-3-4-11(22-2)9(5-8)6-10-12(20)17-14(15)18-13(10)21/h3-5H,6,16H2,1-2H3,(H4,15,17,18,20,21)/b19-7- |
| InChIKey | PZVWZWNCPPFVFE-GXHLCREISA-N |
| XLogP | 0.34 |
| TPSA | 139.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|