C21H31N3O2 — CID 167760325
N-[(2S)-3-methyl-1-[(1-methyl-3,4-dihydro-2H-quinolin-7-yl)amino]-1-oxobutan-2-yl]hex-5-enamide (PubChem CID 167760325) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is N-[(2S)-3-methyl-1-[(1-methyl-3,4-dihydro-2H-quinolin-7-yl)amino]-1-oxobutan-2-yl]hex-5-enamide.
| Compound Name | N-[(2S)-3-methyl-1-[(1-methyl-3,4-dihydro-2H-quinolin-7-yl)amino]-1-oxobutan-2-yl]hex-5-enamide |
|---|---|
| PubChem CID | 167760325 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | N-[(2S)-3-methyl-1-[(1-methyl-3,4-dihydro-2H-quinolin-7-yl)amino]-1-oxobutan-2-yl]hex-5-enamide |
| SMILES | C=CCCCC(=O)N[C@H](C(=O)Nc1ccc2c(c1)N(C)CCC2)C(C)C |
| InChI | InChI=1S/C21H31N3O2/c1-5-6-7-10-19(25)23-20(15(2)3)21(26)22-17-12-11-16-9-8-13-24(4)18(16)14-17/h5,11-12,14-15,20H,1,6-10,13H2,2-4H3,(H,22,26)(H,23,25)/t20-/m0/s1 |
| InChIKey | RBDJFJCFNWPLHC-FQEVSTJZSA-N |
| XLogP | 3.50 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|