C23H21N5OS — CID 167776313
3-[2-[2-(3-but-3-ynyldiazirin-3-yl)ethylsulfanyl]imidazol-1-yl]-N-phenylbenzamide (PubChem CID 167776313) has the molecular formula C23H21N5OS and a molecular weight of 415.52 g/mol. Its IUPAC name is 3-[2-[2-(3-but-3-ynyldiazirin-3-yl)ethylsulfanyl]imidazol-1-yl]-N-phenylbenzamide.
| Compound Name | 3-[2-[2-(3-but-3-ynyldiazirin-3-yl)ethylsulfanyl]imidazol-1-yl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 167776313 |
| Molecular Formula | C23H21N5OS |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 3-[2-[2-(3-but-3-ynyldiazirin-3-yl)ethylsulfanyl]imidazol-1-yl]-N-phenylbenzamide |
| SMILES | C#CCCC1(CCSc2nccn2-c2cccc(C(=O)Nc3ccccc3)c2)N=N1 |
| InChI | InChI=1S/C23H21N5OS/c1-2-3-12-23(26-27-23)13-16-30-22-24-14-15-28(22)20-11-7-8-18(17-20)21(29)25-19-9-5-4-6-10-19/h1,4-11,14-15,17H,3,12-13,16H2,(H,25,29) |
| InChIKey | HGJPJELJXABCEP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|