C16H22N4O2 — CID 167777368
1,1-dimethyl-3-[2-[1-(3-phenyl-1,2-oxazol-5-yl)ethylamino]ethyl]urea (PubChem CID 167777368) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2-[1-(3-phenyl-1,2-oxazol-5-yl)ethylamino]ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[2-[1-(3-phenyl-1,2-oxazol-5-yl)ethylamino]ethyl]urea |
|---|---|
| PubChem CID | 167777368 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 1,1-dimethyl-3-[2-[1-(3-phenyl-1,2-oxazol-5-yl)ethylamino]ethyl]urea |
| SMILES | CC(NCCNC(=O)N(C)C)c1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C16H22N4O2/c1-12(17-9-10-18-16(21)20(2)3)15-11-14(19-22-15)13-7-5-4-6-8-13/h4-8,11-12,17H,9-10H2,1-3H3,(H,18,21) |
| InChIKey | POLCCERUBLJJRN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|