C20H17Cl2NO5 — CID 167777956
N-[4-[3-(2,6-dichlorophenoxy)-2-hydroxypropoxy]phenyl]furan-2-carboxamide (PubChem CID 167777956) has the molecular formula C20H17Cl2NO5 and a molecular weight of 422.26 g/mol. Its IUPAC name is N-[4-[3-(2,6-dichlorophenoxy)-2-hydroxypropoxy]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[3-(2,6-dichlorophenoxy)-2-hydroxypropoxy]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 167777956 |
| Molecular Formula | C20H17Cl2NO5 |
| Molecular Weight | 422.26 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | N-[4-[3-(2,6-dichlorophenoxy)-2-hydroxypropoxy]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(OCC(O)COc2c(Cl)cccc2Cl)cc1)c1ccco1 |
| InChI | InChI=1S/C20H17Cl2NO5/c21-16-3-1-4-17(22)19(16)28-12-14(24)11-27-15-8-6-13(7-9-15)23-20(25)18-5-2-10-26-18/h1-10,14,24H,11-12H2,(H,23,25) |
| InChIKey | QKJYLYHCHNQJER-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.26 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |