C21H21NO5 — CID 46406954
N-[4-[2-hydroxy-3-(3-methylphenoxy)propoxy]phenyl]furan-2-carboxamide (PubChem CID 46406954) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is N-[4-[2-hydroxy-3-(3-methylphenoxy)propoxy]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[2-hydroxy-3-(3-methylphenoxy)propoxy]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46406954 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-[4-[2-hydroxy-3-(3-methylphenoxy)propoxy]phenyl]furan-2-carboxamide |
| SMILES | Cc1cccc(OCC(O)COc2ccc(NC(=O)c3ccco3)cc2)c1 |
| InChI | InChI=1S/C21H21NO5/c1-15-4-2-5-19(12-15)27-14-17(23)13-26-18-9-7-16(8-10-18)22-21(24)20-6-3-11-25-20/h2-12,17,23H,13-14H2,1H3,(H,22,24) |
| InChIKey | CWKVJPHTTLZWAS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |