C20H14ClF2NO3 — CID 167778996
N-[(2-chlorophenyl)-(2,5-difluorophenyl)methyl]-2,4-dihydroxybenzamide (PubChem CID 167778996) has the molecular formula C20H14ClF2NO3 and a molecular weight of 389.79 g/mol. Its IUPAC name is N-[(2-chlorophenyl)-(2,5-difluorophenyl)methyl]-2,4-dihydroxybenzamide.
| Compound Name | N-[(2-chlorophenyl)-(2,5-difluorophenyl)methyl]-2,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 167778996 |
| Molecular Formula | C20H14ClF2NO3 |
| Molecular Weight | 389.79 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | N-[(2-chlorophenyl)-(2,5-difluorophenyl)methyl]-2,4-dihydroxybenzamide |
| SMILES | O=C(NC(c1cc(F)ccc1F)c1ccccc1Cl)c1ccc(O)cc1O |
| InChI | InChI=1S/C20H14ClF2NO3/c21-16-4-2-1-3-13(16)19(15-9-11(22)5-8-17(15)23)24-20(27)14-7-6-12(25)10-18(14)26/h1-10,19,25-26H,(H,24,27) |
| InChIKey | OPBAXBKZNXLINT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.79 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |