C13H16N4O5S — CID 167784679
N-[2-[methyl(1,2-oxazol-5-ylmethyl)amino]ethyl]-2-nitrobenzenesulfonamide (PubChem CID 167784679) has the molecular formula C13H16N4O5S and a molecular weight of 340.36 g/mol. Its IUPAC name is N-[2-[methyl(1,2-oxazol-5-ylmethyl)amino]ethyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[2-[methyl(1,2-oxazol-5-ylmethyl)amino]ethyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 167784679 |
| Molecular Formula | C13H16N4O5S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | N-[2-[methyl(1,2-oxazol-5-ylmethyl)amino]ethyl]-2-nitrobenzenesulfonamide |
| SMILES | CN(CCNS(=O)(=O)c1ccccc1[N+](=O)[O-])Cc1ccno1 |
| InChI | InChI=1S/C13H16N4O5S/c1-16(10-11-6-7-14-22-11)9-8-15-23(20,21)13-5-3-2-4-12(13)17(18)19/h2-7,15H,8-10H2,1H3 |
| InChIKey | RSOBXKKGLKCTEK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 118.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|