C10H10FNO4 — CID 167803726
methyl 5-[(2-fluoroprop-2-enoylamino)methyl]furan-2-carboxylate (PubChem CID 167803726) has the molecular formula C10H10FNO4 and a molecular weight of 227.19 g/mol. Its IUPAC name is methyl 5-[(2-fluoroprop-2-enoylamino)methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(2-fluoroprop-2-enoylamino)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 167803726 |
| Molecular Formula | C10H10FNO4 |
| Molecular Weight | 227.19 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | methyl 5-[(2-fluoroprop-2-enoylamino)methyl]furan-2-carboxylate |
| SMILES | C=C(F)C(=O)NCc1ccc(C(=O)OC)o1 |
| InChI | InChI=1S/C10H10FNO4/c1-6(11)9(13)12-5-7-3-4-8(16-7)10(14)15-2/h3-4H,1,5H2,2H3,(H,12,13) |
| InChIKey | LQRKMGGMERSNSN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|