C9H14FN3O3S — CID 167815771
3-(pentan-3-ylcarbamoyl)-1H-pyrazole-5-sulfonyl fluoride (PubChem CID 167815771) has the molecular formula C9H14FN3O3S and a molecular weight of 263.29 g/mol. Its IUPAC name is 3-(pentan-3-ylcarbamoyl)-1H-pyrazole-5-sulfonyl fluoride.
| Compound Name | 3-(pentan-3-ylcarbamoyl)-1H-pyrazole-5-sulfonyl fluoride |
|---|---|
| PubChem CID | 167815771 |
| Molecular Formula | C9H14FN3O3S |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 3-(pentan-3-ylcarbamoyl)-1H-pyrazole-5-sulfonyl fluoride |
| SMILES | CCC(CC)NC(=O)c1cc(S(=O)(=O)F)[nH]n1 |
| InChI | InChI=1S/C9H14FN3O3S/c1-3-6(4-2)11-9(14)7-5-8(13-12-7)17(10,15)16/h5-6H,3-4H2,1-2H3,(H,11,14)(H,12,13) |
| InChIKey | RORGWZMSJACXBA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |