C8H12FN3O3S — CID 167871200
3-(butylcarbamoyl)-1H-pyrazole-5-sulfonyl fluoride (PubChem CID 167871200) has the molecular formula C8H12FN3O3S and a molecular weight of 249.27 g/mol. Its IUPAC name is 3-(butylcarbamoyl)-1H-pyrazole-5-sulfonyl fluoride.
| Compound Name | 3-(butylcarbamoyl)-1H-pyrazole-5-sulfonyl fluoride |
|---|---|
| PubChem CID | 167871200 |
| Molecular Formula | C8H12FN3O3S |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 3-(butylcarbamoyl)-1H-pyrazole-5-sulfonyl fluoride |
| SMILES | CCCCNC(=O)c1cc(S(=O)(=O)F)[nH]n1 |
| InChI | InChI=1S/C8H12FN3O3S/c1-2-3-4-10-8(13)6-5-7(12-11-6)16(9,14)15/h5H,2-4H2,1H3,(H,10,13)(H,11,12) |
| InChIKey | QGWUEFNTPDQKSB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|