C10H16FN3O3S — CID 167984499
3-(3,3-dimethylbutylcarbamoyl)-1H-pyrazole-5-sulfonyl fluoride (PubChem CID 167984499) has the molecular formula C10H16FN3O3S and a molecular weight of 277.32 g/mol. Its IUPAC name is 3-(3,3-dimethylbutylcarbamoyl)-1H-pyrazole-5-sulfonyl fluoride.
| Compound Name | 3-(3,3-dimethylbutylcarbamoyl)-1H-pyrazole-5-sulfonyl fluoride |
|---|---|
| PubChem CID | 167984499 |
| Molecular Formula | C10H16FN3O3S |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 3-(3,3-dimethylbutylcarbamoyl)-1H-pyrazole-5-sulfonyl fluoride |
| SMILES | CC(C)(C)CCNC(=O)c1cc(S(=O)(=O)F)[nH]n1 |
| InChI | InChI=1S/C10H16FN3O3S/c1-10(2,3)4-5-12-9(15)7-6-8(14-13-7)18(11,16)17/h6H,4-5H2,1-3H3,(H,12,15)(H,13,14) |
| InChIKey | JSZACEKDBXQRDO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |