C6H10N4O4S — CID 175653433
N-(2-hydroxyethyl)-5-sulfamoyl-1H-pyrazole-3-carboxamide (PubChem CID 175653433) has the molecular formula C6H10N4O4S and a molecular weight of 234.24 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-5-sulfamoyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-5-sulfamoyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 175653433 |
| Molecular Formula | C6H10N4O4S |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | N-(2-hydroxyethyl)-5-sulfamoyl-1H-pyrazole-3-carboxamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)NCCO)n[nH]1 |
| InChI | InChI=1S/C6H10N4O4S/c7-15(13,14)5-3-4(9-10-5)6(12)8-1-2-11/h3,11H,1-2H2,(H,8,12)(H,9,10)(H2,7,13,14) |
| InChIKey | ONRWTUXUXGDJEE-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 138.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |