About 6-chloro-N-(3,3-difluorocyclobutyl)-1H-indole-3-sulfonamide
6-chloro-N-(3,3-difluorocyclobutyl)-1H-indole-3-sulfonamide (PubChem CID 167817801) has the molecular formula C12H11ClF2N2O2S
and a molecular weight of 320.75 g/mol. Its IUPAC name is 6-chloro-N-(3,3-difluorocyclobutyl)-1H-indole-3-sulfonamide.
Molecular Properties
| Compound Name | 6-chloro-N-(3,3-difluorocyclobutyl)-1H-indole-3-sulfonamide |
| PubChem CID | 167817801 |
| Molecular Formula | C12H11ClF2N2O2S |
| Molecular Weight | 320.75 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 6-chloro-N-(3,3-difluorocyclobutyl)-1H-indole-3-sulfonamide |
| SMILES | O=S(=O)(NC1CC(F)(F)C1)c1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C12H11ClF2N2O2S/c13-7-1-2-9-10(3-7)16-6-11(9)20(18,19)17-8-4-12(14,15)5-8/h1-3,6,8,16-17H,4-5H2 |
| InChIKey | XWOSMPAJIRHITA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.75 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-N-(3,3-difluorocyclobutyl)-1H-indole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(3,3-difluorocyclobutyl)-1H-indole-3-sulfonamide?
The IUPAC name of 6-chloro-N-(3,3-difluorocyclobutyl)-1H-indole-3-sulfonamide (CID 167817801) is 6-chloro-N-(3,3-difluorocyclobutyl)-1H-indole-3-sulfonamide.
What is the SMILES notation for 6-chloro-N-(3,3-difluorocyclobutyl)-1H-indole-3-sulfonamide?
The canonical SMILES for 6-chloro-N-(3,3-difluorocyclobutyl)-1H-indole-3-sulfonamide is O=S(=O)(NC1CC(F)(F)C1)c1c[nH]c2cc(Cl)ccc12.
What is the InChIKey of 6-chloro-N-(3,3-difluorocyclobutyl)-1H-indole-3-sulfonamide?
The InChIKey is XWOSMPAJIRHITA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClF2N2O2S/c13-7-1-2-9-10(3-7)16-6-11(9)20(18,19)17-8-4-12(14,15)5-8/h1-3,6,8,16-17H,4-5H2.
What are the key properties of 6-chloro-N-(3,3-difluorocyclobutyl)-1H-indole-3-sulfonamide?
6-chloro-N-(3,3-difluorocyclobutyl)-1H-indole-3-sulfonamide has a molecular weight of 320.75 g/mol, XLogP of 2.90, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(3,3-difluorocyclobutyl)-1H-indole-3-sulfonamide is sourced from PubChem (CID 167817801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).