C12H11ClF2N2O2S — CID 167817801
6-chloro-N-(3,3-difluorocyclobutyl)-1H-indole-3-sulfonamide (PubChem CID 167817801) has the molecular formula C12H11ClF2N2O2S and a molecular weight of 320.75 g/mol. Its IUPAC name is 6-chloro-N-(3,3-difluorocyclobutyl)-1H-indole-3-sulfonamide.
| Compound Name | 6-chloro-N-(3,3-difluorocyclobutyl)-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 167817801 |
| Molecular Formula | C12H11ClF2N2O2S |
| Molecular Weight | 320.75 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 6-chloro-N-(3,3-difluorocyclobutyl)-1H-indole-3-sulfonamide |
| SMILES | O=S(=O)(NC1CC(F)(F)C1)c1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C12H11ClF2N2O2S/c13-7-1-2-9-10(3-7)16-6-11(9)20(18,19)17-8-4-12(14,15)5-8/h1-3,6,8,16-17H,4-5H2 |
| InChIKey | XWOSMPAJIRHITA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.75 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |