C15H12BrF2NO4S — CID 167821869
3-bromo-5-[2-(3,4-difluorophenyl)ethylsulfamoyl]benzoic acid (PubChem CID 167821869) has the molecular formula C15H12BrF2NO4S and a molecular weight of 420.23 g/mol. Its IUPAC name is 3-bromo-5-[2-(3,4-difluorophenyl)ethylsulfamoyl]benzoic acid.
| Compound Name | 3-bromo-5-[2-(3,4-difluorophenyl)ethylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 167821869 |
| Molecular Formula | C15H12BrF2NO4S |
| Molecular Weight | 420.23 g/mol |
| Exact Mass | 418.96 |
| IUPAC Name | 3-bromo-5-[2-(3,4-difluorophenyl)ethylsulfamoyl]benzoic acid |
| SMILES | O=C(O)c1cc(Br)cc(S(=O)(=O)NCCc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C15H12BrF2NO4S/c16-11-6-10(15(20)21)7-12(8-11)24(22,23)19-4-3-9-1-2-13(17)14(18)5-9/h1-2,5-8,19H,3-4H2,(H,20,21) |
| InChIKey | GKXBVOALHKFHEF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.23 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |