C9H11ClN2O4 — CID 167823460
5-[(3-chloro-1,2-oxazole-5-carbonyl)amino]pentanoic acid (PubChem CID 167823460) has the molecular formula C9H11ClN2O4 and a molecular weight of 246.65 g/mol. Its IUPAC name is 5-[(3-chloro-1,2-oxazole-5-carbonyl)amino]pentanoic acid.
| Compound Name | 5-[(3-chloro-1,2-oxazole-5-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 167823460 |
| Molecular Formula | C9H11ClN2O4 |
| Molecular Weight | 246.65 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 5-[(3-chloro-1,2-oxazole-5-carbonyl)amino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)c1cc(Cl)no1 |
| InChI | InChI=1S/C9H11ClN2O4/c10-7-5-6(16-12-7)9(15)11-4-2-1-3-8(13)14/h5H,1-4H2,(H,11,15)(H,13,14) |
| InChIKey | RGSGGKVMXSMGGG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.65 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|