About 4-[[3-(3,5-difluorophenoxy)pyrrolidin-1-yl]methyl]-2-(furan-3-yl)-1,3-thiazole
4-[[3-(3,5-difluorophenoxy)pyrrolidin-1-yl]methyl]-2-(furan-3-yl)-1,3-thiazole (PubChem CID 167826148) has the molecular formula C18H16F2N2O2S
and a molecular weight of 362.40 g/mol. Its IUPAC name is 4-[[3-(3,5-difluorophenoxy)pyrrolidin-1-yl]methyl]-2-(furan-3-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 4-[[3-(3,5-difluorophenoxy)pyrrolidin-1-yl]methyl]-2-(furan-3-yl)-1,3-thiazole |
| PubChem CID | 167826148 |
| Molecular Formula | C18H16F2N2O2S |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 4-[[3-(3,5-difluorophenoxy)pyrrolidin-1-yl]methyl]-2-(furan-3-yl)-1,3-thiazole |
| SMILES | Fc1cc(F)cc(OC2CCN(Cc3csc(-c4ccoc4)n3)C2)c1 |
| InChI | InChI=1S/C18H16F2N2O2S/c19-13-5-14(20)7-17(6-13)24-16-1-3-22(9-16)8-15-11-25-18(21-15)12-2-4-23-10-12/h2,4-7,10-11,16H,1,3,8-9H2 |
| InChIKey | XLZBIRPJMJQREO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[3-(3,5-difluorophenoxy)pyrrolidin-1-yl]methyl]-2-(furan-3-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-(3,5-difluorophenoxy)pyrrolidin-1-yl]methyl]-2-(furan-3-yl)-1,3-thiazole?
The IUPAC name of 4-[[3-(3,5-difluorophenoxy)pyrrolidin-1-yl]methyl]-2-(furan-3-yl)-1,3-thiazole (CID 167826148) is 4-[[3-(3,5-difluorophenoxy)pyrrolidin-1-yl]methyl]-2-(furan-3-yl)-1,3-thiazole.
What is the SMILES notation for 4-[[3-(3,5-difluorophenoxy)pyrrolidin-1-yl]methyl]-2-(furan-3-yl)-1,3-thiazole?
The canonical SMILES for 4-[[3-(3,5-difluorophenoxy)pyrrolidin-1-yl]methyl]-2-(furan-3-yl)-1,3-thiazole is Fc1cc(F)cc(OC2CCN(Cc3csc(-c4ccoc4)n3)C2)c1.
What is the InChIKey of 4-[[3-(3,5-difluorophenoxy)pyrrolidin-1-yl]methyl]-2-(furan-3-yl)-1,3-thiazole?
The InChIKey is XLZBIRPJMJQREO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F2N2O2S/c19-13-5-14(20)7-17(6-13)24-16-1-3-22(9-16)8-15-11-25-18(21-15)12-2-4-23-10-12/h2,4-7,10-11,16H,1,3,8-9H2.
What are the key properties of 4-[[3-(3,5-difluorophenoxy)pyrrolidin-1-yl]methyl]-2-(furan-3-yl)-1,3-thiazole?
4-[[3-(3,5-difluorophenoxy)pyrrolidin-1-yl]methyl]-2-(furan-3-yl)-1,3-thiazole has a molecular weight of 362.40 g/mol, XLogP of 4.33, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-(3,5-difluorophenoxy)pyrrolidin-1-yl]methyl]-2-(furan-3-yl)-1,3-thiazole is sourced from PubChem (CID 167826148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).