C16H16N2O6 — CID 167832425
(5-methyl-2-oxooxolan-3-yl) 3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate (PubChem CID 167832425) has the molecular formula C16H16N2O6 and a molecular weight of 332.31 g/mol. Its IUPAC name is (5-methyl-2-oxooxolan-3-yl) 3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate.
| Compound Name | (5-methyl-2-oxooxolan-3-yl) 3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 167832425 |
| Molecular Formula | C16H16N2O6 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (5-methyl-2-oxooxolan-3-yl) 3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
| SMILES | CC1CC(OC(=O)c2cccc(CN3C(=O)CNC3=O)c2)C(=O)O1 |
| InChI | InChI=1S/C16H16N2O6/c1-9-5-12(15(21)23-9)24-14(20)11-4-2-3-10(6-11)8-18-13(19)7-17-16(18)22/h2-4,6,9,12H,5,7-8H2,1H3,(H,17,22) |
| InChIKey | CFPDLRYAYLWAIG-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|