C13H12O4 — CID 167837079
2-[(3-oxo-1,2-dihydroinden-4-yl)oxymethyl]prop-2-enoic acid (PubChem CID 167837079) has the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. Its IUPAC name is 2-[(3-oxo-1,2-dihydroinden-4-yl)oxymethyl]prop-2-enoic acid.
| Compound Name | 2-[(3-oxo-1,2-dihydroinden-4-yl)oxymethyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 167837079 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 2-[(3-oxo-1,2-dihydroinden-4-yl)oxymethyl]prop-2-enoic acid |
| SMILES | C=C(COc1cccc2c1C(=O)CC2)C(=O)O |
| InChI | InChI=1S/C13H12O4/c1-8(13(15)16)7-17-11-4-2-3-9-5-6-10(14)12(9)11/h2-4H,1,5-7H2,(H,15,16) |
| InChIKey | VDANCJSTMMWPFT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|