C9H9O4PS — CID 20545951
7-dihydroxyphosphinothioyloxy-2,3-dihydroinden-1-one (PubChem CID 20545951) has the molecular formula C9H9O4PS and a molecular weight of 244.21 g/mol. Its IUPAC name is 7-dihydroxyphosphinothioyloxy-2,3-dihydroinden-1-one.
| Compound Name | 7-dihydroxyphosphinothioyloxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 20545951 |
| Molecular Formula | C9H9O4PS |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.00 |
| IUPAC Name | 7-dihydroxyphosphinothioyloxy-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2cccc(OP(O)(O)=S)c21 |
| InChI | InChI=1S/C9H9O4PS/c10-7-5-4-6-2-1-3-8(9(6)7)13-14(11,12)15/h1-3H,4-5H2,(H2,11,12,15) |
| InChIKey | BOJFRUNJTBNERS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|