C23H20ClN5O5S — CID 167837770
2-[2-(3-chloro-4-cyanophenyl)imino-4-oxo-3-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-1,3-thiazolidin-5-yl]-N-(4-hydroxyphenyl)acetamide (PubChem CID 167837770) has the molecular formula C23H20ClN5O5S and a molecular weight of 513.96 g/mol. Its IUPAC name is 2-[2-(3-chloro-4-cyanophenyl)imino-4-oxo-3-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-1,3-thiazolidin-5-yl]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[2-(3-chloro-4-cyanophenyl)imino-4-oxo-3-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-1,3-thiazolidin-5-yl]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 167837770 |
| Molecular Formula | C23H20ClN5O5S |
| Molecular Weight | 513.96 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | 2-[2-(3-chloro-4-cyanophenyl)imino-4-oxo-3-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-1,3-thiazolidin-5-yl]-N-(4-hydroxyphenyl)acetamide |
| SMILES | N#Cc1ccc(/N=C2\SC(CC(=O)Nc3ccc(O)cc3)C(=O)N2CCN2CCOC2=O)cc1Cl |
| InChI | InChI=1S/C23H20ClN5O5S/c24-18-11-16(2-1-14(18)13-25)27-22-29(8-7-28-9-10-34-23(28)33)21(32)19(35-22)12-20(31)26-15-3-5-17(30)6-4-15/h1-6,11,19,30H,7-10,12H2,(H,26,31)/b27-22- |
| InChIKey | BHVFXDZAGXQRFB-QYQHSDTDSA-N |
| XLogP | 3.33 |
| TPSA | 135.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.96 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|