C12H11FN4O — CID 167841210
(E)-4-fluoro-N-(4-phenyl-1,2,4-triazol-3-yl)but-2-enamide (PubChem CID 167841210) has the molecular formula C12H11FN4O and a molecular weight of 246.25 g/mol. Its IUPAC name is (E)-4-fluoro-N-(4-phenyl-1,2,4-triazol-3-yl)but-2-enamide.
| Compound Name | (E)-4-fluoro-N-(4-phenyl-1,2,4-triazol-3-yl)but-2-enamide |
|---|---|
| PubChem CID | 167841210 |
| Molecular Formula | C12H11FN4O |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (E)-4-fluoro-N-(4-phenyl-1,2,4-triazol-3-yl)but-2-enamide |
| SMILES | O=C(/C=C/CF)Nc1nncn1-c1ccccc1 |
| InChI | InChI=1S/C12H11FN4O/c13-8-4-7-11(18)15-12-16-14-9-17(12)10-5-2-1-3-6-10/h1-7,9H,8H2,(H,15,16,18)/b7-4+ |
| InChIKey | IXEOPCRSCRCTAK-QPJJXVBHSA-N |
| XLogP | 1.73 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|