C9H8F4N2O4S — CID 167859676
methyl 6-fluoro-4-(2,2,2-trifluoroethylsulfonylamino)pyridine-3-carboxylate (PubChem CID 167859676) has the molecular formula C9H8F4N2O4S and a molecular weight of 316.23 g/mol. Its IUPAC name is methyl 6-fluoro-4-(2,2,2-trifluoroethylsulfonylamino)pyridine-3-carboxylate.
| Compound Name | methyl 6-fluoro-4-(2,2,2-trifluoroethylsulfonylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 167859676 |
| Molecular Formula | C9H8F4N2O4S |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | methyl 6-fluoro-4-(2,2,2-trifluoroethylsulfonylamino)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(F)cc1NS(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C9H8F4N2O4S/c1-19-8(16)5-3-14-7(10)2-6(5)15-20(17,18)4-9(11,12)13/h2-3H,4H2,1H3,(H,14,15) |
| InChIKey | ZBWNYMRUDJQJJA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|