C23H20F2N2O2 — CID 167890494
2-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]-N-(naphthalen-1-ylmethyl)-2-oxoacetamide (PubChem CID 167890494) has the molecular formula C23H20F2N2O2 and a molecular weight of 394.42 g/mol. Its IUPAC name is 2-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]-N-(naphthalen-1-ylmethyl)-2-oxoacetamide.
| Compound Name | 2-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]-N-(naphthalen-1-ylmethyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 167890494 |
| Molecular Formula | C23H20F2N2O2 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]-N-(naphthalen-1-ylmethyl)-2-oxoacetamide |
| SMILES | O=C(NCc1cccc2ccccc12)C(=O)N1CCCC1c1cc(F)ccc1F |
| InChI | InChI=1S/C23H20F2N2O2/c24-17-10-11-20(25)19(13-17)21-9-4-12-27(21)23(29)22(28)26-14-16-7-3-6-15-5-1-2-8-18(15)16/h1-3,5-8,10-11,13,21H,4,9,12,14H2,(H,26,28) |
| InChIKey | FEOJGKZZWFUNRH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|