C24H22F2N2O2 — CID 50804171
N-(2,4-difluorophenyl)-1-(2-naphthalen-1-ylacetyl)piperidine-3-carboxamide (PubChem CID 50804171) has the molecular formula C24H22F2N2O2 and a molecular weight of 408.45 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-1-(2-naphthalen-1-ylacetyl)piperidine-3-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-1-(2-naphthalen-1-ylacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 50804171 |
| Molecular Formula | C24H22F2N2O2 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-(2,4-difluorophenyl)-1-(2-naphthalen-1-ylacetyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)C1CCCN(C(=O)Cc2cccc3ccccc23)C1 |
| InChI | InChI=1S/C24H22F2N2O2/c25-19-10-11-22(21(26)14-19)27-24(30)18-8-4-12-28(15-18)23(29)13-17-7-3-6-16-5-1-2-9-20(16)17/h1-3,5-7,9-11,14,18H,4,8,12-13,15H2,(H,27,30) |
| InChIKey | KLYKWVUHJMXLIP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |